About (4-nitrophenyl) thiohypochlorite;propane
(4-nitrophenyl) thiohypochlorite;propane (PubChem CID 144684047) has the molecular formula C9H12ClNO2S
and a molecular weight of 233.72 g/mol. Its IUPAC name is (4-nitrophenyl) thiohypochlorite;propane.
Molecular Properties
| Compound Name | (4-nitrophenyl) thiohypochlorite;propane |
| PubChem CID | 144684047 |
| Molecular Formula | C9H12ClNO2S |
| Molecular Weight | 233.72 g/mol |
| Exact Mass | 233.03 |
| IUPAC Name | (4-nitrophenyl) thiohypochlorite;propane |
| SMILES | CCC.O=[N+]([O-])c1ccc(SCl)cc1 |
| InChI | InChI=1S/C6H4ClNO2S.C3H8/c7-11-6-3-1-5(2-4-6)8(9)10;1-3-2/h1-4H;3H2,1-2H3 |
| InChIKey | RMKZYLTZCCVNGW-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.72 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4-nitrophenyl) thiohypochlorite;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-nitrophenyl) thiohypochlorite;propane?
The IUPAC name of (4-nitrophenyl) thiohypochlorite;propane (CID 144684047) is (4-nitrophenyl) thiohypochlorite;propane.
What is the SMILES notation for (4-nitrophenyl) thiohypochlorite;propane?
The canonical SMILES for (4-nitrophenyl) thiohypochlorite;propane is CCC.O=[N+]([O-])c1ccc(SCl)cc1.
What is the InChIKey of (4-nitrophenyl) thiohypochlorite;propane?
The InChIKey is RMKZYLTZCCVNGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4ClNO2S.C3H8/c7-11-6-3-1-5(2-4-6)8(9)10;1-3-2/h1-4H;3H2,1-2H3.
What are the key properties of (4-nitrophenyl) thiohypochlorite;propane?
(4-nitrophenyl) thiohypochlorite;propane has a molecular weight of 233.72 g/mol, XLogP of 4.26, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-nitrophenyl) thiohypochlorite;propane is sourced from PubChem (CID 144684047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).