C16H17NO2S — CID 91879901
1,2-diethyl-4-(4-nitrophenyl)sulfanylbenzene (PubChem CID 91879901) has the molecular formula C16H17NO2S and a molecular weight of 287.38 g/mol. Its IUPAC name is 1,2-diethyl-4-(4-nitrophenyl)sulfanylbenzene.
| Compound Name | 1,2-diethyl-4-(4-nitrophenyl)sulfanylbenzene |
|---|---|
| PubChem CID | 91879901 |
| Molecular Formula | C16H17NO2S |
| Molecular Weight | 287.38 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | 1,2-diethyl-4-(4-nitrophenyl)sulfanylbenzene |
| SMILES | CCc1ccc(Sc2ccc([N+](=O)[O-])cc2)cc1CC |
| InChI | InChI=1S/C16H17NO2S/c1-3-12-5-8-16(11-13(12)4-2)20-15-9-6-14(7-10-15)17(18)19/h5-11H,3-4H2,1-2H3 |
| InChIKey | UPUBCLMMAHXMMC-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.38 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|