About azane;1-ethyl-4-nitrobenzene
azane;1-ethyl-4-nitrobenzene (PubChem CID 19043225) has the molecular formula C8H12N2O2
and a molecular weight of 168.20 g/mol. Its IUPAC name is azane;1-ethyl-4-nitrobenzene.
Molecular Properties
| Compound Name | azane;1-ethyl-4-nitrobenzene |
| PubChem CID | 19043225 |
| Molecular Formula | C8H12N2O2 |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.09 |
| IUPAC Name | azane;1-ethyl-4-nitrobenzene |
| SMILES | CCc1ccc([N+](=O)[O-])cc1.N |
| InChI | InChI=1S/C8H9NO2.H3N/c1-2-7-3-5-8(6-4-7)9(10)11;/h3-6H,2H2,1H3;1H3 |
| InChIKey | RXBZGPUAKGGJRX-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 78.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze azane;1-ethyl-4-nitrobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;1-ethyl-4-nitrobenzene?
The IUPAC name of azane;1-ethyl-4-nitrobenzene (CID 19043225) is azane;1-ethyl-4-nitrobenzene.
What is the SMILES notation for azane;1-ethyl-4-nitrobenzene?
The canonical SMILES for azane;1-ethyl-4-nitrobenzene is CCc1ccc([N+](=O)[O-])cc1.N.
What is the InChIKey of azane;1-ethyl-4-nitrobenzene?
The InChIKey is RXBZGPUAKGGJRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO2.H3N/c1-2-7-3-5-8(6-4-7)9(10)11;/h3-6H,2H2,1H3;1H3.
What are the key properties of azane;1-ethyl-4-nitrobenzene?
azane;1-ethyl-4-nitrobenzene has a molecular weight of 168.20 g/mol, XLogP of 2.32, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azane;1-ethyl-4-nitrobenzene is sourced from PubChem (CID 19043225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).