About 1-nitro-4-propylbenzene;propan-1-amine
1-nitro-4-propylbenzene;propan-1-amine (PubChem CID 144859121) has the molecular formula C12H20N2O2
and a molecular weight of 224.30 g/mol. Its IUPAC name is 1-nitro-4-propylbenzene;propan-1-amine.
Molecular Properties
| Compound Name | 1-nitro-4-propylbenzene;propan-1-amine |
| PubChem CID | 144859121 |
| Molecular Formula | C12H20N2O2 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | 1-nitro-4-propylbenzene;propan-1-amine |
| SMILES | CCCN.CCCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C9H11NO2.C3H9N/c1-2-3-8-4-6-9(7-5-8)10(11)12;1-2-3-4/h4-7H,2-3H2,1H3;2-4H2,1H3 |
| InChIKey | KBBWIFVTTUMZBG-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-nitro-4-propylbenzene;propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-nitro-4-propylbenzene;propan-1-amine?
The IUPAC name of 1-nitro-4-propylbenzene;propan-1-amine (CID 144859121) is 1-nitro-4-propylbenzene;propan-1-amine.
What is the SMILES notation for 1-nitro-4-propylbenzene;propan-1-amine?
The canonical SMILES for 1-nitro-4-propylbenzene;propan-1-amine is CCCN.CCCc1ccc([N+](=O)[O-])cc1.
What is the InChIKey of 1-nitro-4-propylbenzene;propan-1-amine?
The InChIKey is KBBWIFVTTUMZBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO2.C3H9N/c1-2-3-8-4-6-9(7-5-8)10(11)12;1-2-3-4/h4-7H,2-3H2,1H3;2-4H2,1H3.
What are the key properties of 1-nitro-4-propylbenzene;propan-1-amine?
1-nitro-4-propylbenzene;propan-1-amine has a molecular weight of 224.30 g/mol, XLogP of 2.90, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-nitro-4-propylbenzene;propan-1-amine is sourced from PubChem (CID 144859121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).