About ethane;1-nitro-4-propylbenzene
ethane;1-nitro-4-propylbenzene (PubChem CID 123575523) has the molecular formula C13H23NO2
and a molecular weight of 225.33 g/mol. Its IUPAC name is ethane;1-nitro-4-propylbenzene.
Molecular Properties
| Compound Name | ethane;1-nitro-4-propylbenzene |
| PubChem CID | 123575523 |
| Molecular Formula | C13H23NO2 |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.17 |
| IUPAC Name | ethane;1-nitro-4-propylbenzene |
| SMILES | CC.CC.CCCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C9H11NO2.2C2H6/c1-2-3-8-4-6-9(7-5-8)10(11)12;2*1-2/h4-7H,2-3H2,1H3;2*1-2H3 |
| InChIKey | OFCHPNVKRMXQPK-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-nitro-4-propylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-nitro-4-propylbenzene?
The IUPAC name of ethane;1-nitro-4-propylbenzene (CID 123575523) is ethane;1-nitro-4-propylbenzene.
What is the SMILES notation for ethane;1-nitro-4-propylbenzene?
The canonical SMILES for ethane;1-nitro-4-propylbenzene is CC.CC.CCCc1ccc([N+](=O)[O-])cc1.
What is the InChIKey of ethane;1-nitro-4-propylbenzene?
The InChIKey is OFCHPNVKRMXQPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO2.2C2H6/c1-2-3-8-4-6-9(7-5-8)10(11)12;2*1-2/h4-7H,2-3H2,1H3;2*1-2H3.
What are the key properties of ethane;1-nitro-4-propylbenzene?
ethane;1-nitro-4-propylbenzene has a molecular weight of 225.33 g/mol, XLogP of 4.60, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-nitro-4-propylbenzene is sourced from PubChem (CID 123575523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).