About hydron;2-(4-nitrophenyl)ethanol
hydron;2-(4-nitrophenyl)ethanol (PubChem CID 131851380) has the molecular formula C8H10NO3+
and a molecular weight of 168.17 g/mol. Its IUPAC name is hydron;2-(4-nitrophenyl)ethanol.
Molecular Properties
| Compound Name | hydron;2-(4-nitrophenyl)ethanol |
| PubChem CID | 131851380 |
| Molecular Formula | C8H10NO3+ |
| Molecular Weight | 168.17 g/mol |
| Exact Mass | 168.07 |
| IUPAC Name | hydron;2-(4-nitrophenyl)ethanol |
| SMILES | O=[N+]([O-])c1ccc(CCO)cc1.[H+] |
| InChI | InChI=1S/C8H9NO3/c10-6-5-7-1-3-8(4-2-7)9(11)12/h1-4,10H,5-6H2/p+1 |
| InChIKey | IKMXRUOZUUKSON-UHFFFAOYSA-O |
| XLogP | 1.24 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.17 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze hydron;2-(4-nitrophenyl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydron;2-(4-nitrophenyl)ethanol?
The IUPAC name of hydron;2-(4-nitrophenyl)ethanol (CID 131851380) is hydron;2-(4-nitrophenyl)ethanol.
What is the SMILES notation for hydron;2-(4-nitrophenyl)ethanol?
The canonical SMILES for hydron;2-(4-nitrophenyl)ethanol is O=[N+]([O-])c1ccc(CCO)cc1.[H+].
What is the InChIKey of hydron;2-(4-nitrophenyl)ethanol?
The InChIKey is IKMXRUOZUUKSON-UHFFFAOYSA-O. The full InChI is InChI=1S/C8H9NO3/c10-6-5-7-1-3-8(4-2-7)9(11)12/h1-4,10H,5-6H2/p+1.
What are the key properties of hydron;2-(4-nitrophenyl)ethanol?
hydron;2-(4-nitrophenyl)ethanol has a molecular weight of 168.17 g/mol, XLogP of 1.24, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for hydron;2-(4-nitrophenyl)ethanol is sourced from PubChem (CID 131851380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).