About 1-[2-(6-bromohexoxy)ethyl]-4-nitrobenzene;2-(4-nitrophenyl)ethanol
1-[2-(6-bromohexoxy)ethyl]-4-nitrobenzene;2-(4-nitrophenyl)ethanol (PubChem CID 88597380) has the molecular formula C22H29BrN2O6
and a molecular weight of 497.39 g/mol. Its IUPAC name is 1-[2-(6-bromohexoxy)ethyl]-4-nitrobenzene;2-(4-nitrophenyl)ethanol.
Molecular Properties
| Compound Name | 1-[2-(6-bromohexoxy)ethyl]-4-nitrobenzene;2-(4-nitrophenyl)ethanol |
| PubChem CID | 88597380 |
| Molecular Formula | C22H29BrN2O6 |
| Molecular Weight | 497.39 g/mol |
| Exact Mass | 496.12 |
| IUPAC Name | 1-[2-(6-bromohexoxy)ethyl]-4-nitrobenzene;2-(4-nitrophenyl)ethanol |
| SMILES | O=[N+]([O-])c1ccc(CCO)cc1.O=[N+]([O-])c1ccc(CCOCCCCCCBr)cc1 |
| InChI | InChI=1S/C14H20BrNO3.C8H9NO3/c15-10-3-1-2-4-11-19-12-9-13-5-7-14(8-6-13)16(17)18;10-6-5-7-1-3-8(4-2-7)9(11)12/h5-8H,1-4,9-12H2;1-4,10H,5-6H2 |
| InChIKey | WUIBABJPIDXFOP-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 115.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 497.39 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-(6-bromohexoxy)ethyl]-4-nitrobenzene;2-(4-nitrophenyl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(6-bromohexoxy)ethyl]-4-nitrobenzene;2-(4-nitrophenyl)ethanol?
The IUPAC name of 1-[2-(6-bromohexoxy)ethyl]-4-nitrobenzene;2-(4-nitrophenyl)ethanol (CID 88597380) is 1-[2-(6-bromohexoxy)ethyl]-4-nitrobenzene;2-(4-nitrophenyl)ethanol.
What is the SMILES notation for 1-[2-(6-bromohexoxy)ethyl]-4-nitrobenzene;2-(4-nitrophenyl)ethanol?
The canonical SMILES for 1-[2-(6-bromohexoxy)ethyl]-4-nitrobenzene;2-(4-nitrophenyl)ethanol is O=[N+]([O-])c1ccc(CCO)cc1.O=[N+]([O-])c1ccc(CCOCCCCCCBr)cc1.
What is the InChIKey of 1-[2-(6-bromohexoxy)ethyl]-4-nitrobenzene;2-(4-nitrophenyl)ethanol?
The InChIKey is WUIBABJPIDXFOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20BrNO3.C8H9NO3/c15-10-3-1-2-4-11-19-12-9-13-5-7-14(8-6-13)16(17)18;10-6-5-7-1-3-8(4-2-7)9(11)12/h5-8H,1-4,9-12H2;1-4,10H,5-6H2.
What are the key properties of 1-[2-(6-bromohexoxy)ethyl]-4-nitrobenzene;2-(4-nitrophenyl)ethanol?
1-[2-(6-bromohexoxy)ethyl]-4-nitrobenzene;2-(4-nitrophenyl)ethanol has a molecular weight of 497.39 g/mol, XLogP of 5.24, 13 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(6-bromohexoxy)ethyl]-4-nitrobenzene;2-(4-nitrophenyl)ethanol is sourced from PubChem (CID 88597380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).