9-(4-nitrophenyl)nonyl hydrogen carbonate

C16H23NO5 — CID 178069653

IUPAC9-(4-nitrophenyl)nonyl hydrogen carbonate
SMILESO=C(O)OCCCCCCCCCc1ccc([N+](=O)[O-])cc1
InChIInChI=1S/C16H23NO5/c18-16(19)22-13-7-5-3-1-2-4-6-8-14-9-11-15(12-10-14)17(20)21/h9-12H,1-8,13H2,(H,18,19)
InChIKeySMJIAWSZUPKTLR-UHFFFAOYSA-N
MW309.36 g/mol
LogP4.56
Rot. Bonds11

About 9-(4-nitrophenyl)nonyl hydrogen carbonate

9-(4-nitrophenyl)nonyl hydrogen carbonate (PubChem CID 178069653) has the molecular formula C16H23NO5 and a molecular weight of 309.36 g/mol. Its IUPAC name is 9-(4-nitrophenyl)nonyl hydrogen carbonate.

Molecular Properties

Compound Name9-(4-nitrophenyl)nonyl hydrogen carbonate
PubChem CID178069653
Molecular FormulaC16H23NO5
Molecular Weight309.36 g/mol
Exact Mass309.16
IUPAC Name9-(4-nitrophenyl)nonyl hydrogen carbonate
SMILESO=C(O)OCCCCCCCCCc1ccc([N+](=O)[O-])cc1
InChIInChI=1S/C16H23NO5/c18-16(19)22-13-7-5-3-1-2-4-6-8-14-9-11-15(12-10-14)17(20)21/h9-12H,1-8,13H2,(H,18,19)
InChIKeySMJIAWSZUPKTLR-UHFFFAOYSA-N
XLogP4.56
TPSA89.67 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds11
Heavy Atoms22
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500309.36
LogP ≤ 54.56
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 9-(4-nitrophenyl)nonyl hydrogen carbonate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 9-(4-nitrophenyl)nonyl hydrogen carbonate?
The IUPAC name of 9-(4-nitrophenyl)nonyl hydrogen carbonate (CID 178069653) is 9-(4-nitrophenyl)nonyl hydrogen carbonate.
What is the SMILES notation for 9-(4-nitrophenyl)nonyl hydrogen carbonate?
The canonical SMILES for 9-(4-nitrophenyl)nonyl hydrogen carbonate is O=C(O)OCCCCCCCCCc1ccc([N+](=O)[O-])cc1.
What is the InChIKey of 9-(4-nitrophenyl)nonyl hydrogen carbonate?
The InChIKey is SMJIAWSZUPKTLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23NO5/c18-16(19)22-13-7-5-3-1-2-4-6-8-14-9-11-15(12-10-14)17(20)21/h9-12H,1-8,13H2,(H,18,19).
What are the key properties of 9-(4-nitrophenyl)nonyl hydrogen carbonate?
9-(4-nitrophenyl)nonyl hydrogen carbonate has a molecular weight of 309.36 g/mol, XLogP of 4.56, 11 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(4-nitrophenyl)nonyl hydrogen carbonate is sourced from PubChem (CID 178069653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).