C19H21ClN2O4 — CID 6736750
4-(4-nitrophenyl)butyl N-[2-(3-chlorophenyl)ethyl]carbamate (PubChem CID 6736750) has the molecular formula C19H21ClN2O4 and a molecular weight of 376.84 g/mol. Its IUPAC name is 4-(4-nitrophenyl)butyl N-[2-(3-chlorophenyl)ethyl]carbamate.
| Compound Name | 4-(4-nitrophenyl)butyl N-[2-(3-chlorophenyl)ethyl]carbamate |
|---|---|
| PubChem CID | 6736750 |
| Molecular Formula | C19H21ClN2O4 |
| Molecular Weight | 376.84 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | 4-(4-nitrophenyl)butyl N-[2-(3-chlorophenyl)ethyl]carbamate |
| SMILES | O=C(NCCc1cccc(Cl)c1)OCCCCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H21ClN2O4/c20-17-6-3-5-16(14-17)11-12-21-19(23)26-13-2-1-4-15-7-9-18(10-8-15)22(24)25/h3,5-10,14H,1-2,4,11-13H2,(H,21,23) |
| InChIKey | VEOPIQCGHRQAJE-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.84 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|