C15H18N2O4 — CID 10935154
[(3E)-hexa-3,5-dienyl] N-[2-(4-nitrophenyl)ethyl]carbamate (PubChem CID 10935154) has the molecular formula C15H18N2O4 and a molecular weight of 290.32 g/mol. Its IUPAC name is [(3E)-hexa-3,5-dienyl] N-[2-(4-nitrophenyl)ethyl]carbamate.
| Compound Name | [(3E)-hexa-3,5-dienyl] N-[2-(4-nitrophenyl)ethyl]carbamate |
|---|---|
| PubChem CID | 10935154 |
| Molecular Formula | C15H18N2O4 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | [(3E)-hexa-3,5-dienyl] N-[2-(4-nitrophenyl)ethyl]carbamate |
| SMILES | C=C/C=C/CCOC(=O)NCCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H18N2O4/c1-2-3-4-5-12-21-15(18)16-11-10-13-6-8-14(9-7-13)17(19)20/h2-4,6-9H,1,5,10-12H2,(H,16,18)/b4-3+ |
| InChIKey | FVXVOUHTHRFAEJ-ONEGZZNKSA-N |
| XLogP | 3.00 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|