About 5-(4-nitrophenyl)pentyl acetate
5-(4-nitrophenyl)pentyl acetate (PubChem CID 101451915) has the molecular formula C13H17NO4
and a molecular weight of 251.28 g/mol. Its IUPAC name is 5-(4-nitrophenyl)pentyl acetate.
Molecular Properties
| Compound Name | 5-(4-nitrophenyl)pentyl acetate |
| PubChem CID | 101451915 |
| Molecular Formula | C13H17NO4 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | 5-(4-nitrophenyl)pentyl acetate |
| SMILES | CC(=O)OCCCCCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H17NO4/c1-11(15)18-10-4-2-3-5-12-6-8-13(9-7-12)14(16)17/h6-9H,2-5,10H2,1H3 |
| InChIKey | RAGLFAAEMGCKBE-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-(4-nitrophenyl)pentyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-nitrophenyl)pentyl acetate?
The IUPAC name of 5-(4-nitrophenyl)pentyl acetate (CID 101451915) is 5-(4-nitrophenyl)pentyl acetate.
What is the SMILES notation for 5-(4-nitrophenyl)pentyl acetate?
The canonical SMILES for 5-(4-nitrophenyl)pentyl acetate is CC(=O)OCCCCCc1ccc([N+](=O)[O-])cc1.
What is the InChIKey of 5-(4-nitrophenyl)pentyl acetate?
The InChIKey is RAGLFAAEMGCKBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO4/c1-11(15)18-10-4-2-3-5-12-6-8-13(9-7-12)14(16)17/h6-9H,2-5,10H2,1H3.
What are the key properties of 5-(4-nitrophenyl)pentyl acetate?
5-(4-nitrophenyl)pentyl acetate has a molecular weight of 251.28 g/mol, XLogP of 2.87, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-nitrophenyl)pentyl acetate is sourced from PubChem (CID 101451915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).