About 4-(4-iodophenyl)butyl acetate
4-(4-iodophenyl)butyl acetate (PubChem CID 67358099) has the molecular formula C12H15IO2
and a molecular weight of 318.15 g/mol. Its IUPAC name is 4-(4-iodophenyl)butyl acetate.
Molecular Properties
| Compound Name | 4-(4-iodophenyl)butyl acetate |
| PubChem CID | 67358099 |
| Molecular Formula | C12H15IO2 |
| Molecular Weight | 318.15 g/mol |
| Exact Mass | 318.01 |
| IUPAC Name | 4-(4-iodophenyl)butyl acetate |
| SMILES | CC(=O)OCCCCc1ccc(I)cc1 |
| InChI | InChI=1S/C12H15IO2/c1-10(14)15-9-3-2-4-11-5-7-12(13)8-6-11/h5-8H,2-4,9H2,1H3 |
| InChIKey | BZDSTAHIXANUAZ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.15 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-iodophenyl)butyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-iodophenyl)butyl acetate?
The IUPAC name of 4-(4-iodophenyl)butyl acetate (CID 67358099) is 4-(4-iodophenyl)butyl acetate.
What is the SMILES notation for 4-(4-iodophenyl)butyl acetate?
The canonical SMILES for 4-(4-iodophenyl)butyl acetate is CC(=O)OCCCCc1ccc(I)cc1.
What is the InChIKey of 4-(4-iodophenyl)butyl acetate?
The InChIKey is BZDSTAHIXANUAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15IO2/c1-10(14)15-9-3-2-4-11-5-7-12(13)8-6-11/h5-8H,2-4,9H2,1H3.
What are the key properties of 4-(4-iodophenyl)butyl acetate?
4-(4-iodophenyl)butyl acetate has a molecular weight of 318.15 g/mol, XLogP of 3.18, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-iodophenyl)butyl acetate is sourced from PubChem (CID 67358099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).