About 6-[2-(4-iodophenyl)acetyl]oxyhexyl 2-(4-iodophenyl)acetate
6-[2-(4-iodophenyl)acetyl]oxyhexyl 2-(4-iodophenyl)acetate (PubChem CID 132581734) has the molecular formula C22H24I2O4
and a molecular weight of 606.24 g/mol. Its IUPAC name is 6-[2-(4-iodophenyl)acetyl]oxyhexyl 2-(4-iodophenyl)acetate.
Molecular Properties
| Compound Name | 6-[2-(4-iodophenyl)acetyl]oxyhexyl 2-(4-iodophenyl)acetate |
| PubChem CID | 132581734 |
| Molecular Formula | C22H24I2O4 |
| Molecular Weight | 606.24 g/mol |
| Exact Mass | 605.98 |
| IUPAC Name | 6-[2-(4-iodophenyl)acetyl]oxyhexyl 2-(4-iodophenyl)acetate |
| SMILES | O=C(Cc1ccc(I)cc1)OCCCCCCOC(=O)Cc1ccc(I)cc1 |
| InChI | InChI=1S/C22H24I2O4/c23-19-9-5-17(6-10-19)15-21(25)27-13-3-1-2-4-14-28-22(26)16-18-7-11-20(24)12-8-18/h5-12H,1-4,13-16H2 |
| InChIKey | CQQSMKFTCVPJSL-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 606.24 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 6-[2-(4-iodophenyl)acetyl]oxyhexyl 2-(4-iodophenyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[2-(4-iodophenyl)acetyl]oxyhexyl 2-(4-iodophenyl)acetate?
The IUPAC name of 6-[2-(4-iodophenyl)acetyl]oxyhexyl 2-(4-iodophenyl)acetate (CID 132581734) is 6-[2-(4-iodophenyl)acetyl]oxyhexyl 2-(4-iodophenyl)acetate.
What is the SMILES notation for 6-[2-(4-iodophenyl)acetyl]oxyhexyl 2-(4-iodophenyl)acetate?
The canonical SMILES for 6-[2-(4-iodophenyl)acetyl]oxyhexyl 2-(4-iodophenyl)acetate is O=C(Cc1ccc(I)cc1)OCCCCCCOC(=O)Cc1ccc(I)cc1.
What is the InChIKey of 6-[2-(4-iodophenyl)acetyl]oxyhexyl 2-(4-iodophenyl)acetate?
The InChIKey is CQQSMKFTCVPJSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24I2O4/c23-19-9-5-17(6-10-19)15-21(25)27-13-3-1-2-4-14-28-22(26)16-18-7-11-20(24)12-8-18/h5-12H,1-4,13-16H2.
What are the key properties of 6-[2-(4-iodophenyl)acetyl]oxyhexyl 2-(4-iodophenyl)acetate?
6-[2-(4-iodophenyl)acetyl]oxyhexyl 2-(4-iodophenyl)acetate has a molecular weight of 606.24 g/mol, XLogP of 5.33, 11 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[2-(4-iodophenyl)acetyl]oxyhexyl 2-(4-iodophenyl)acetate is sourced from PubChem (CID 132581734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).