C25H36NO3+ — CID 18345332
trimethyl-[4-[2-oxo-2-(8-phenoxyoctoxy)ethyl]phenyl]azanium (PubChem CID 18345332) has the molecular formula C25H36NO3+ and a molecular weight of 398.57 g/mol. Its IUPAC name is trimethyl-[4-[2-oxo-2-(8-phenoxyoctoxy)ethyl]phenyl]azanium.
| Compound Name | trimethyl-[4-[2-oxo-2-(8-phenoxyoctoxy)ethyl]phenyl]azanium |
|---|---|
| PubChem CID | 18345332 |
| Molecular Formula | C25H36NO3+ |
| Molecular Weight | 398.57 g/mol |
| Exact Mass | 398.27 |
| IUPAC Name | trimethyl-[4-[2-oxo-2-(8-phenoxyoctoxy)ethyl]phenyl]azanium |
| SMILES | C[N+](C)(C)c1ccc(CC(=O)OCCCCCCCCOc2ccccc2)cc1 |
| InChI | InChI=1S/C25H36NO3/c1-26(2,3)23-17-15-22(16-18-23)21-25(27)29-20-12-7-5-4-6-11-19-28-24-13-9-8-10-14-24/h8-10,13-18H,4-7,11-12,19-21H2,1-3H3/q+1 |
| InChIKey | DSMPGIUGVMTZOU-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.57 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|