C34H42NO4+ — CID 11505648
trimethyl-[4-[2-oxo-2-[8-[4-[(E)-3-oxo-3-phenylprop-1-enyl]phenoxy]octoxy]ethyl]phenyl]azanium (PubChem CID 11505648) has the molecular formula C34H42NO4+ and a molecular weight of 528.71 g/mol. Its IUPAC name is trimethyl-[4-[2-oxo-2-[8-[4-[(E)-3-oxo-3-phenylprop-1-enyl]phenoxy]octoxy]ethyl]phenyl]azanium.
| Compound Name | trimethyl-[4-[2-oxo-2-[8-[4-[(E)-3-oxo-3-phenylprop-1-enyl]phenoxy]octoxy]ethyl]phenyl]azanium |
|---|---|
| PubChem CID | 11505648 |
| Molecular Formula | C34H42NO4+ |
| Molecular Weight | 528.71 g/mol |
| Exact Mass | 528.31 |
| IUPAC Name | trimethyl-[4-[2-oxo-2-[8-[4-[(E)-3-oxo-3-phenylprop-1-enyl]phenoxy]octoxy]ethyl]phenyl]azanium |
| SMILES | C[N+](C)(C)c1ccc(CC(=O)OCCCCCCCCOc2ccc(/C=C/C(=O)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C34H42NO4/c1-35(2,3)31-20-15-29(16-21-31)27-34(37)39-26-12-7-5-4-6-11-25-38-32-22-17-28(18-23-32)19-24-33(36)30-13-9-8-10-14-30/h8-10,13-24H,4-7,11-12,25-27H2,1-3H3/q+1/b24-19+ |
| InChIKey | RUDSFXKPTPRWLI-LYBHJNIJSA-N |
| XLogP | 7.28 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.71 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|