C27H30N2O3 — CID 67045783
3-[4-[6-(2,4-diaminophenoxy)hexoxy]phenyl]-1-phenylprop-2-en-1-one (PubChem CID 67045783) has the molecular formula C27H30N2O3 and a molecular weight of 430.55 g/mol. Its IUPAC name is 3-[4-[6-(2,4-diaminophenoxy)hexoxy]phenyl]-1-phenylprop-2-en-1-one.
| Compound Name | 3-[4-[6-(2,4-diaminophenoxy)hexoxy]phenyl]-1-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 67045783 |
| Molecular Formula | C27H30N2O3 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.23 |
| IUPAC Name | 3-[4-[6-(2,4-diaminophenoxy)hexoxy]phenyl]-1-phenylprop-2-en-1-one |
| SMILES | Nc1ccc(OCCCCCCOc2ccc(C=CC(=O)c3ccccc3)cc2)c(N)c1 |
| InChI | InChI=1S/C27H30N2O3/c28-23-13-17-27(25(29)20-23)32-19-7-2-1-6-18-31-24-14-10-21(11-15-24)12-16-26(30)22-8-4-3-5-9-22/h3-5,8-17,20H,1-2,6-7,18-19,28-29H2 |
| InChIKey | XTOSOIKWDSANOW-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|