C33H28O4 — CID 92531173
(Z)-3-[4-[3-[4-[(Z)-3-oxo-3-phenylprop-1-enyl]phenoxy]propoxy]phenyl]-1-phenylprop-2-en-1-one (PubChem CID 92531173) has the molecular formula C33H28O4 and a molecular weight of 488.58 g/mol. Its IUPAC name is (Z)-3-[4-[3-[4-[(Z)-3-oxo-3-phenylprop-1-enyl]phenoxy]propoxy]phenyl]-1-phenylprop-2-en-1-one.
| Compound Name | (Z)-3-[4-[3-[4-[(Z)-3-oxo-3-phenylprop-1-enyl]phenoxy]propoxy]phenyl]-1-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 92531173 |
| Molecular Formula | C33H28O4 |
| Molecular Weight | 488.58 g/mol |
| Exact Mass | 488.20 |
| IUPAC Name | (Z)-3-[4-[3-[4-[(Z)-3-oxo-3-phenylprop-1-enyl]phenoxy]propoxy]phenyl]-1-phenylprop-2-en-1-one |
| SMILES | O=C(/C=C\c1ccc(OCCCOc2ccc(/C=C\C(=O)c3ccccc3)cc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C33H28O4/c34-32(28-8-3-1-4-9-28)22-16-26-12-18-30(19-13-26)36-24-7-25-37-31-20-14-27(15-21-31)17-23-33(35)29-10-5-2-6-11-29/h1-6,8-23H,7,24-25H2/b22-16-,23-17- |
| InChIKey | PGRWJZWSBPJOHK-IDUDEYGOSA-N |
| XLogP | 7.33 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.58 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|