C33H28O5 — CID 95241953
(E)-1-[4-[(2R)-2-hydroxy-3-[4-[(E)-3-oxo-3-phenylprop-1-enyl]phenoxy]propoxy]phenyl]-3-phenylprop-2-en-1-one (PubChem CID 95241953) has the molecular formula C33H28O5 and a molecular weight of 504.58 g/mol. Its IUPAC name is (E)-1-[4-[(2R)-2-hydroxy-3-[4-[(E)-3-oxo-3-phenylprop-1-enyl]phenoxy]propoxy]phenyl]-3-phenylprop-2-en-1-one.
| Compound Name | (E)-1-[4-[(2R)-2-hydroxy-3-[4-[(E)-3-oxo-3-phenylprop-1-enyl]phenoxy]propoxy]phenyl]-3-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 95241953 |
| Molecular Formula | C33H28O5 |
| Molecular Weight | 504.58 g/mol |
| Exact Mass | 504.19 |
| IUPAC Name | (E)-1-[4-[(2R)-2-hydroxy-3-[4-[(E)-3-oxo-3-phenylprop-1-enyl]phenoxy]propoxy]phenyl]-3-phenylprop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(OC[C@@H](O)COc2ccc(C(=O)/C=C/c3ccccc3)cc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C33H28O5/c34-29(23-37-30-17-11-26(12-18-30)14-22-32(35)27-9-5-2-6-10-27)24-38-31-19-15-28(16-20-31)33(36)21-13-25-7-3-1-4-8-25/h1-22,29,34H,23-24H2/b21-13+,22-14+/t29-/m1/s1 |
| InChIKey | IBKMCILNGFJQRC-WSBXTCMRSA-N |
| XLogP | 6.30 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.58 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|