C23H28O4 — CID 67779014
1-[4-(2,4-dimethoxyhexoxy)phenyl]-3-phenylprop-2-en-1-one (PubChem CID 67779014) has the molecular formula C23H28O4 and a molecular weight of 368.47 g/mol. Its IUPAC name is 1-[4-(2,4-dimethoxyhexoxy)phenyl]-3-phenylprop-2-en-1-one.
| Compound Name | 1-[4-(2,4-dimethoxyhexoxy)phenyl]-3-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 67779014 |
| Molecular Formula | C23H28O4 |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | 1-[4-(2,4-dimethoxyhexoxy)phenyl]-3-phenylprop-2-en-1-one |
| SMILES | CCC(CC(COc1ccc(C(=O)C=Cc2ccccc2)cc1)OC)OC |
| InChI | InChI=1S/C23H28O4/c1-4-20(25-2)16-22(26-3)17-27-21-13-11-19(12-14-21)23(24)15-10-18-8-6-5-7-9-18/h5-15,20,22H,4,16-17H2,1-3H3 |
| InChIKey | HBTJSFRHKQPARP-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|