C27H37NO2 — CID 118715723
(E)-1-[4-[4-(dibutylamino)butoxy]phenyl]-3-phenylprop-2-en-1-one (PubChem CID 118715723) has the molecular formula C27H37NO2 and a molecular weight of 407.60 g/mol. Its IUPAC name is (E)-1-[4-[4-(dibutylamino)butoxy]phenyl]-3-phenylprop-2-en-1-one.
| Compound Name | (E)-1-[4-[4-(dibutylamino)butoxy]phenyl]-3-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 118715723 |
| Molecular Formula | C27H37NO2 |
| Molecular Weight | 407.60 g/mol |
| Exact Mass | 407.28 |
| IUPAC Name | (E)-1-[4-[4-(dibutylamino)butoxy]phenyl]-3-phenylprop-2-en-1-one |
| SMILES | CCCCN(CCCC)CCCCOc1ccc(C(=O)/C=C/c2ccccc2)cc1 |
| InChI | InChI=1S/C27H37NO2/c1-3-5-20-28(21-6-4-2)22-10-11-23-30-26-17-15-25(16-18-26)27(29)19-14-24-12-8-7-9-13-24/h7-9,12-19H,3-6,10-11,20-23H2,1-2H3/b19-14+ |
| InChIKey | GTRFZKVGZAEOAG-XMHGGMMESA-N |
| XLogP | 6.64 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.60 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|