C19H18Cl2O3 — CID 2751350
1,3-bis[4-(2-chloroethoxy)phenyl]prop-2-en-1-one (PubChem CID 2751350) has the molecular formula C19H18Cl2O3 and a molecular weight of 365.26 g/mol. Its IUPAC name is 1,3-bis[4-(2-chloroethoxy)phenyl]prop-2-en-1-one.
| Compound Name | 1,3-bis[4-(2-chloroethoxy)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 2751350 |
| Molecular Formula | C19H18Cl2O3 |
| Molecular Weight | 365.26 g/mol |
| Exact Mass | 364.06 |
| IUPAC Name | 1,3-bis[4-(2-chloroethoxy)phenyl]prop-2-en-1-one |
| SMILES | O=C(C=Cc1ccc(OCCCl)cc1)c1ccc(OCCCl)cc1 |
| InChI | InChI=1S/C19H18Cl2O3/c20-11-13-23-17-6-1-15(2-7-17)3-10-19(22)16-4-8-18(9-5-16)24-14-12-21/h1-10H,11-14H2 |
| InChIKey | YKIOVSIYPURDOC-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.26 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|