C19H17O4- — CID 8828157
4-[(E)-3-oxo-3-(4-propoxyphenyl)prop-1-enyl]benzoate (PubChem CID 8828157) has the molecular formula C19H17O4- and a molecular weight of 309.34 g/mol. Its IUPAC name is 4-[(E)-3-oxo-3-(4-propoxyphenyl)prop-1-enyl]benzoate.
| Compound Name | 4-[(E)-3-oxo-3-(4-propoxyphenyl)prop-1-enyl]benzoate |
|---|---|
| PubChem CID | 8828157 |
| Molecular Formula | C19H17O4- |
| Molecular Weight | 309.34 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 4-[(E)-3-oxo-3-(4-propoxyphenyl)prop-1-enyl]benzoate |
| SMILES | CCCOc1ccc(C(=O)/C=C/c2ccc(C(=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C19H18O4/c1-2-13-23-17-10-8-15(9-11-17)18(20)12-5-14-3-6-16(7-4-14)19(21)22/h3-12H,2,13H2,1H3,(H,21,22)/p-1/b12-5+ |
| InChIKey | LPMOBKUSJOLMJO-LFYBBSHMSA-M |
| XLogP | 2.73 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.34 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|