C20H19O5- — CID 9447720
2-[4-[(E)-3-(4-propoxyphenyl)prop-2-enoyl]phenoxy]acetate (PubChem CID 9447720) has the molecular formula C20H19O5- and a molecular weight of 339.37 g/mol. Its IUPAC name is 2-[4-[(E)-3-(4-propoxyphenyl)prop-2-enoyl]phenoxy]acetate.
| Compound Name | 2-[4-[(E)-3-(4-propoxyphenyl)prop-2-enoyl]phenoxy]acetate |
|---|---|
| PubChem CID | 9447720 |
| Molecular Formula | C20H19O5- |
| Molecular Weight | 339.37 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | 2-[4-[(E)-3-(4-propoxyphenyl)prop-2-enoyl]phenoxy]acetate |
| SMILES | CCCOc1ccc(/C=C/C(=O)c2ccc(OCC(=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C20H20O5/c1-2-13-24-17-8-3-15(4-9-17)5-12-19(21)16-6-10-18(11-7-16)25-14-20(22)23/h3-12H,2,13-14H2,1H3,(H,22,23)/p-1/b12-5+ |
| InChIKey | YGXINTLINKCMLX-LFYBBSHMSA-M |
| XLogP | 2.50 |
| TPSA | 75.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.37 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|