C21H15O4- — CID 7991083
2-[4-[(E)-3-naphthalen-2-yl-3-oxoprop-1-enyl]phenoxy]acetate (PubChem CID 7991083) has the molecular formula C21H15O4- and a molecular weight of 331.35 g/mol. Its IUPAC name is 2-[4-[(E)-3-naphthalen-2-yl-3-oxoprop-1-enyl]phenoxy]acetate.
| Compound Name | 2-[4-[(E)-3-naphthalen-2-yl-3-oxoprop-1-enyl]phenoxy]acetate |
|---|---|
| PubChem CID | 7991083 |
| Molecular Formula | C21H15O4- |
| Molecular Weight | 331.35 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | 2-[4-[(E)-3-naphthalen-2-yl-3-oxoprop-1-enyl]phenoxy]acetate |
| SMILES | O=C([O-])COc1ccc(/C=C/C(=O)c2ccc3ccccc3c2)cc1 |
| InChI | InChI=1S/C21H16O4/c22-20(18-9-8-16-3-1-2-4-17(16)13-18)12-7-15-5-10-19(11-6-15)25-14-21(23)24/h1-13H,14H2,(H,23,24)/p-1/b12-7+ |
| InChIKey | LWCCJWPDZSJHGM-KPKJPENVSA-M |
| XLogP | 2.86 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.35 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|