C19H17O6- — CID 8856878
2-[2-methoxy-4-[(E)-3-(4-methoxyphenyl)-3-oxoprop-1-enyl]phenoxy]acetate (PubChem CID 8856878) has the molecular formula C19H17O6- and a molecular weight of 341.34 g/mol. Its IUPAC name is 2-[2-methoxy-4-[(E)-3-(4-methoxyphenyl)-3-oxoprop-1-enyl]phenoxy]acetate.
| Compound Name | 2-[2-methoxy-4-[(E)-3-(4-methoxyphenyl)-3-oxoprop-1-enyl]phenoxy]acetate |
|---|---|
| PubChem CID | 8856878 |
| Molecular Formula | C19H17O6- |
| Molecular Weight | 341.34 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | 2-[2-methoxy-4-[(E)-3-(4-methoxyphenyl)-3-oxoprop-1-enyl]phenoxy]acetate |
| SMILES | COc1ccc(C(=O)/C=C/c2ccc(OCC(=O)[O-])c(OC)c2)cc1 |
| InChI | InChI=1S/C19H18O6/c1-23-15-7-5-14(6-8-15)16(20)9-3-13-4-10-17(18(11-13)24-2)25-12-19(21)22/h3-11H,12H2,1-2H3,(H,21,22)/p-1/b9-3+ |
| InChIKey | FNJCBIDSJKQBJO-YCRREMRBSA-M |
| XLogP | 1.73 |
| TPSA | 84.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.34 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|