C20H19O7- — CID 8832808
2-[4-[(E)-3-(2,4-dimethoxyphenyl)-3-oxoprop-1-enyl]-2-methoxyphenoxy]acetate (PubChem CID 8832808) has the molecular formula C20H19O7- and a molecular weight of 371.37 g/mol. Its IUPAC name is 2-[4-[(E)-3-(2,4-dimethoxyphenyl)-3-oxoprop-1-enyl]-2-methoxyphenoxy]acetate.
| Compound Name | 2-[4-[(E)-3-(2,4-dimethoxyphenyl)-3-oxoprop-1-enyl]-2-methoxyphenoxy]acetate |
|---|---|
| PubChem CID | 8832808 |
| Molecular Formula | C20H19O7- |
| Molecular Weight | 371.37 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | 2-[4-[(E)-3-(2,4-dimethoxyphenyl)-3-oxoprop-1-enyl]-2-methoxyphenoxy]acetate |
| SMILES | COc1ccc(C(=O)/C=C/c2ccc(OCC(=O)[O-])c(OC)c2)c(OC)c1 |
| InChI | InChI=1S/C20H20O7/c1-24-14-6-7-15(18(11-14)25-2)16(21)8-4-13-5-9-17(19(10-13)26-3)27-12-20(22)23/h4-11H,12H2,1-3H3,(H,22,23)/p-1/b8-4+ |
| InChIKey | YNFNKFXFODMPNJ-XBXARRHUSA-M |
| XLogP | 1.74 |
| TPSA | 94.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.37 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|