C24H22O5 — CID 71593022
(E)-1-(2,4-dimethoxyphenyl)-3-(3-methoxy-4-phenoxyphenyl)prop-2-en-1-one (PubChem CID 71593022) has the molecular formula C24H22O5 and a molecular weight of 390.44 g/mol. Its IUPAC name is (E)-1-(2,4-dimethoxyphenyl)-3-(3-methoxy-4-phenoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-(2,4-dimethoxyphenyl)-3-(3-methoxy-4-phenoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 71593022 |
| Molecular Formula | C24H22O5 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | (E)-1-(2,4-dimethoxyphenyl)-3-(3-methoxy-4-phenoxyphenyl)prop-2-en-1-one |
| SMILES | COc1ccc(C(=O)/C=C/c2ccc(Oc3ccccc3)c(OC)c2)c(OC)c1 |
| InChI | InChI=1S/C24H22O5/c1-26-19-11-12-20(23(16-19)27-2)21(25)13-9-17-10-14-22(24(15-17)28-3)29-18-7-5-4-6-8-18/h4-16H,1-3H3/b13-9+ |
| InChIKey | OWLHBZQJHHMUAT-UKTHLTGXSA-N |
| XLogP | 5.40 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|