C25H22O6 — CID 5089614
[4-[3-(2,4-dimethoxyphenyl)-3-oxoprop-1-enyl]phenyl] 3-methoxybenzoate (PubChem CID 5089614) has the molecular formula C25H22O6 and a molecular weight of 418.45 g/mol. Its IUPAC name is [4-[3-(2,4-dimethoxyphenyl)-3-oxoprop-1-enyl]phenyl] 3-methoxybenzoate.
| Compound Name | [4-[3-(2,4-dimethoxyphenyl)-3-oxoprop-1-enyl]phenyl] 3-methoxybenzoate |
|---|---|
| PubChem CID | 5089614 |
| Molecular Formula | C25H22O6 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | [4-[3-(2,4-dimethoxyphenyl)-3-oxoprop-1-enyl]phenyl] 3-methoxybenzoate |
| SMILES | COc1cccc(C(=O)Oc2ccc(C=CC(=O)c3ccc(OC)cc3OC)cc2)c1 |
| InChI | InChI=1S/C25H22O6/c1-28-20-6-4-5-18(15-20)25(27)31-19-10-7-17(8-11-19)9-14-23(26)22-13-12-21(29-2)16-24(22)30-3/h4-16H,1-3H3 |
| InChIKey | RXOGXTOQWYZZLR-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|