C17H18NO3+ — CID 6446756
(E)-1-(2,4-dimethoxyphenyl)-3-(1-methylpyridin-1-ium-4-yl)prop-2-en-1-one (PubChem CID 6446756) has the molecular formula C17H18NO3+ and a molecular weight of 284.34 g/mol. Its IUPAC name is (E)-1-(2,4-dimethoxyphenyl)-3-(1-methylpyridin-1-ium-4-yl)prop-2-en-1-one.
| Compound Name | (E)-1-(2,4-dimethoxyphenyl)-3-(1-methylpyridin-1-ium-4-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 6446756 |
| Molecular Formula | C17H18NO3+ |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | (E)-1-(2,4-dimethoxyphenyl)-3-(1-methylpyridin-1-ium-4-yl)prop-2-en-1-one |
| SMILES | COc1ccc(C(=O)/C=C/c2cc[n+](C)cc2)c(OC)c1 |
| InChI | InChI=1S/C17H18NO3/c1-18-10-8-13(9-11-18)4-7-16(19)15-6-5-14(20-2)12-17(15)21-3/h4-12H,1-3H3/q+1/b7-4+ |
| InChIKey | OWDSUEJZEXJCSV-QPJJXVBHSA-N |
| XLogP | 2.42 |
| TPSA | 39.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|