C16H16ClNO3 — CID 6446753
(E)-1-(2,4-dimethoxyphenyl)-3-pyridin-4-ylprop-2-en-1-one;hydrochloride (PubChem CID 6446753) has the molecular formula C16H16ClNO3 and a molecular weight of 305.76 g/mol. Its IUPAC name is (E)-1-(2,4-dimethoxyphenyl)-3-pyridin-4-ylprop-2-en-1-one;hydrochloride.
| Compound Name | (E)-1-(2,4-dimethoxyphenyl)-3-pyridin-4-ylprop-2-en-1-one;hydrochloride |
|---|---|
| PubChem CID | 6446753 |
| Molecular Formula | C16H16ClNO3 |
| Molecular Weight | 305.76 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | (E)-1-(2,4-dimethoxyphenyl)-3-pyridin-4-ylprop-2-en-1-one;hydrochloride |
| SMILES | COc1ccc(C(=O)/C=C/c2ccncc2)c(OC)c1.Cl |
| InChI | InChI=1S/C16H15NO3.ClH/c1-19-13-4-5-14(16(11-13)20-2)15(18)6-3-12-7-9-17-10-8-12;/h3-11H,1-2H3;1H/b6-3+; |
| InChIKey | YWPZRBYWEMUSSH-ZIKNSQGESA-N |
| XLogP | 3.42 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.76 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|