C28H26O6 — CID 4203282
1-(2,4-dimethoxyphenyl)-3-[3-[3-(2,4-dimethoxyphenyl)-3-oxoprop-1-enyl]phenyl]prop-2-en-1-one (PubChem CID 4203282) has the molecular formula C28H26O6 and a molecular weight of 458.51 g/mol. Its IUPAC name is 1-(2,4-dimethoxyphenyl)-3-[3-[3-(2,4-dimethoxyphenyl)-3-oxoprop-1-enyl]phenyl]prop-2-en-1-one.
| Compound Name | 1-(2,4-dimethoxyphenyl)-3-[3-[3-(2,4-dimethoxyphenyl)-3-oxoprop-1-enyl]phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 4203282 |
| Molecular Formula | C28H26O6 |
| Molecular Weight | 458.51 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | 1-(2,4-dimethoxyphenyl)-3-[3-[3-(2,4-dimethoxyphenyl)-3-oxoprop-1-enyl]phenyl]prop-2-en-1-one |
| SMILES | COc1ccc(C(=O)C=Cc2cccc(C=CC(=O)c3ccc(OC)cc3OC)c2)c(OC)c1 |
| InChI | InChI=1S/C28H26O6/c1-31-21-10-12-23(27(17-21)33-3)25(29)14-8-19-6-5-7-20(16-19)9-15-26(30)24-13-11-22(32-2)18-28(24)34-4/h5-18H,1-4H3 |
| InChIKey | UFBHJDKYSAJELP-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.51 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|