C28H28O5 — CID 6124665
[3-[(E)-3-(2,4-dimethoxyphenyl)-3-oxoprop-1-enyl]phenyl] 4-tert-butylbenzoate (PubChem CID 6124665) has the molecular formula C28H28O5 and a molecular weight of 444.53 g/mol. Its IUPAC name is [3-[(E)-3-(2,4-dimethoxyphenyl)-3-oxoprop-1-enyl]phenyl] 4-tert-butylbenzoate.
| Compound Name | [3-[(E)-3-(2,4-dimethoxyphenyl)-3-oxoprop-1-enyl]phenyl] 4-tert-butylbenzoate |
|---|---|
| PubChem CID | 6124665 |
| Molecular Formula | C28H28O5 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | [3-[(E)-3-(2,4-dimethoxyphenyl)-3-oxoprop-1-enyl]phenyl] 4-tert-butylbenzoate |
| SMILES | COc1ccc(C(=O)/C=C/c2cccc(OC(=O)c3ccc(C(C)(C)C)cc3)c2)c(OC)c1 |
| InChI | InChI=1S/C28H28O5/c1-28(2,3)21-12-10-20(11-13-21)27(30)33-23-8-6-7-19(17-23)9-16-25(29)24-15-14-22(31-4)18-26(24)32-5/h6-18H,1-5H3/b16-9+ |
| InChIKey | DEMQYWGTSKJVIH-CXUHLZMHSA-N |
| XLogP | 6.12 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|