C19H20O6 — CID 8832774
(E)-1-(2,4-dimethoxyphenyl)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-en-1-one (PubChem CID 8832774) has the molecular formula C19H20O6 and a molecular weight of 344.36 g/mol. Its IUPAC name is (E)-1-(2,4-dimethoxyphenyl)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-(2,4-dimethoxyphenyl)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 8832774 |
| Molecular Formula | C19H20O6 |
| Molecular Weight | 344.36 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | (E)-1-(2,4-dimethoxyphenyl)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-en-1-one |
| SMILES | COc1ccc(C(=O)/C=C/c2cc(OC)c(O)c(OC)c2)c(OC)c1 |
| InChI | InChI=1S/C19H20O6/c1-22-13-6-7-14(16(11-13)23-2)15(20)8-5-12-9-17(24-3)19(21)18(10-12)25-4/h5-11,21H,1-4H3/b8-5+ |
| InChIKey | DDOJUXVSITTXLC-VMPITWQZSA-N |
| XLogP | 3.32 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.36 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|