C18H17NO7 — CID 5222560
1-(2,4-dimethoxyphenyl)-3-(4-hydroxy-3-methoxy-5-nitrophenyl)prop-2-en-1-one (PubChem CID 5222560) has the molecular formula C18H17NO7 and a molecular weight of 359.33 g/mol. Its IUPAC name is 1-(2,4-dimethoxyphenyl)-3-(4-hydroxy-3-methoxy-5-nitrophenyl)prop-2-en-1-one.
| Compound Name | 1-(2,4-dimethoxyphenyl)-3-(4-hydroxy-3-methoxy-5-nitrophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 5222560 |
| Molecular Formula | C18H17NO7 |
| Molecular Weight | 359.33 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | 1-(2,4-dimethoxyphenyl)-3-(4-hydroxy-3-methoxy-5-nitrophenyl)prop-2-en-1-one |
| SMILES | COc1ccc(C(=O)C=Cc2cc(OC)c(O)c([N+](=O)[O-])c2)c(OC)c1 |
| InChI | InChI=1S/C18H17NO7/c1-24-12-5-6-13(16(10-12)25-2)15(20)7-4-11-8-14(19(22)23)18(21)17(9-11)26-3/h4-10,21H,1-3H3 |
| InChIKey | QRMRCYFHMCWCJY-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 108.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.33 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|