C16H10Cl3NO5 — CID 6112370
(E)-3-(4-hydroxy-3-methoxy-5-nitrophenyl)-1-(2,3,4-trichlorophenyl)prop-2-en-1-one (PubChem CID 6112370) has the molecular formula C16H10Cl3NO5 and a molecular weight of 402.62 g/mol. Its IUPAC name is (E)-3-(4-hydroxy-3-methoxy-5-nitrophenyl)-1-(2,3,4-trichlorophenyl)prop-2-en-1-one.
| Compound Name | (E)-3-(4-hydroxy-3-methoxy-5-nitrophenyl)-1-(2,3,4-trichlorophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 6112370 |
| Molecular Formula | C16H10Cl3NO5 |
| Molecular Weight | 402.62 g/mol |
| Exact Mass | 400.96 |
| IUPAC Name | (E)-3-(4-hydroxy-3-methoxy-5-nitrophenyl)-1-(2,3,4-trichlorophenyl)prop-2-en-1-one |
| SMILES | COc1cc(/C=C/C(=O)c2ccc(Cl)c(Cl)c2Cl)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C16H10Cl3NO5/c1-25-13-7-8(6-11(16(13)22)20(23)24)2-5-12(21)9-3-4-10(17)15(19)14(9)18/h2-7,22H,1H3/b5-2+ |
| InChIKey | ZVQVSPLAEXYSLA-GORDUTHDSA-N |
| XLogP | 5.17 |
| TPSA | 89.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.62 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|