C16H9Cl2FNO5- — CID 9042285
4-[(E)-3-(2,6-dichloro-3-fluorophenyl)-3-oxoprop-1-enyl]-2-methoxy-6-nitrophenolate (PubChem CID 9042285) has the molecular formula C16H9Cl2FNO5- and a molecular weight of 385.15 g/mol. Its IUPAC name is 4-[(E)-3-(2,6-dichloro-3-fluorophenyl)-3-oxoprop-1-enyl]-2-methoxy-6-nitrophenolate.
| Compound Name | 4-[(E)-3-(2,6-dichloro-3-fluorophenyl)-3-oxoprop-1-enyl]-2-methoxy-6-nitrophenolate |
|---|---|
| PubChem CID | 9042285 |
| Molecular Formula | C16H9Cl2FNO5- |
| Molecular Weight | 385.15 g/mol |
| Exact Mass | 383.98 |
| IUPAC Name | 4-[(E)-3-(2,6-dichloro-3-fluorophenyl)-3-oxoprop-1-enyl]-2-methoxy-6-nitrophenolate |
| SMILES | COc1cc(/C=C/C(=O)c2c(Cl)ccc(F)c2Cl)cc([N+](=O)[O-])c1[O-] |
| InChI | InChI=1S/C16H10Cl2FNO5/c1-25-13-7-8(6-11(16(13)22)20(23)24)2-5-12(21)14-9(17)3-4-10(19)15(14)18/h2-7,22H,1H3/p-1/b5-2+ |
| InChIKey | YUYVOXDOIIHJGP-GORDUTHDSA-M |
| XLogP | 4.02 |
| TPSA | 92.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.15 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|