C19H18NO5- — CID 9448442
2-methoxy-6-nitro-4-[(E)-3-oxo-3-(2,4,6-trimethylphenyl)prop-1-enyl]phenolate (PubChem CID 9448442) has the molecular formula C19H18NO5- and a molecular weight of 340.36 g/mol. Its IUPAC name is 2-methoxy-6-nitro-4-[(E)-3-oxo-3-(2,4,6-trimethylphenyl)prop-1-enyl]phenolate.
| Compound Name | 2-methoxy-6-nitro-4-[(E)-3-oxo-3-(2,4,6-trimethylphenyl)prop-1-enyl]phenolate |
|---|---|
| PubChem CID | 9448442 |
| Molecular Formula | C19H18NO5- |
| Molecular Weight | 340.36 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 2-methoxy-6-nitro-4-[(E)-3-oxo-3-(2,4,6-trimethylphenyl)prop-1-enyl]phenolate |
| SMILES | COc1cc(/C=C/C(=O)c2c(C)cc(C)cc2C)cc([N+](=O)[O-])c1[O-] |
| InChI | InChI=1S/C19H19NO5/c1-11-7-12(2)18(13(3)8-11)16(21)6-5-14-9-15(20(23)24)19(22)17(10-14)25-4/h5-10,22H,1-4H3/p-1/b6-5+ |
| InChIKey | IJHDDCYACNBEPE-AATRIKPKSA-M |
| XLogP | 3.50 |
| TPSA | 92.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.36 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|