C16H14NO6- — CID 9034070
4-[(E)-3-(2,5-dimethylfuran-3-yl)-3-oxoprop-1-enyl]-2-methoxy-6-nitrophenolate (PubChem CID 9034070) has the molecular formula C16H14NO6- and a molecular weight of 316.29 g/mol. Its IUPAC name is 4-[(E)-3-(2,5-dimethylfuran-3-yl)-3-oxoprop-1-enyl]-2-methoxy-6-nitrophenolate.
| Compound Name | 4-[(E)-3-(2,5-dimethylfuran-3-yl)-3-oxoprop-1-enyl]-2-methoxy-6-nitrophenolate |
|---|---|
| PubChem CID | 9034070 |
| Molecular Formula | C16H14NO6- |
| Molecular Weight | 316.29 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | 4-[(E)-3-(2,5-dimethylfuran-3-yl)-3-oxoprop-1-enyl]-2-methoxy-6-nitrophenolate |
| SMILES | COc1cc(/C=C/C(=O)c2cc(C)oc2C)cc([N+](=O)[O-])c1[O-] |
| InChI | InChI=1S/C16H15NO6/c1-9-6-12(10(2)23-9)14(18)5-4-11-7-13(17(20)21)16(19)15(8-11)22-3/h4-8,19H,1-3H3/p-1/b5-4+ |
| InChIKey | TXGIJIWFEHNCCB-SNAWJCMRSA-M |
| XLogP | 2.78 |
| TPSA | 105.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.29 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|