C16H15NO6 — CID 9034071
(E)-1-(2,5-dimethylfuran-3-yl)-3-(4-hydroxy-3-methoxy-5-nitrophenyl)prop-2-en-1-one (PubChem CID 9034071) has the molecular formula C16H15NO6 and a molecular weight of 317.30 g/mol. Its IUPAC name is (E)-1-(2,5-dimethylfuran-3-yl)-3-(4-hydroxy-3-methoxy-5-nitrophenyl)prop-2-en-1-one.
| Compound Name | (E)-1-(2,5-dimethylfuran-3-yl)-3-(4-hydroxy-3-methoxy-5-nitrophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 9034071 |
| Molecular Formula | C16H15NO6 |
| Molecular Weight | 317.30 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | (E)-1-(2,5-dimethylfuran-3-yl)-3-(4-hydroxy-3-methoxy-5-nitrophenyl)prop-2-en-1-one |
| SMILES | COc1cc(/C=C/C(=O)c2cc(C)oc2C)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C16H15NO6/c1-9-6-12(10(2)23-9)14(18)5-4-11-7-13(17(20)21)16(19)15(8-11)22-3/h4-8,19H,1-3H3/b5-4+ |
| InChIKey | TXGIJIWFEHNCCB-SNAWJCMRSA-N |
| XLogP | 3.41 |
| TPSA | 102.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.30 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|