C18H15NO7 — CID 4815919
1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-(4-hydroxy-3-methoxy-5-nitrophenyl)prop-2-en-1-one (PubChem CID 4815919) has the molecular formula C18H15NO7 and a molecular weight of 357.32 g/mol. Its IUPAC name is 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-(4-hydroxy-3-methoxy-5-nitrophenyl)prop-2-en-1-one.
| Compound Name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-(4-hydroxy-3-methoxy-5-nitrophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 4815919 |
| Molecular Formula | C18H15NO7 |
| Molecular Weight | 357.32 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-(4-hydroxy-3-methoxy-5-nitrophenyl)prop-2-en-1-one |
| SMILES | COc1cc(C=CC(=O)c2ccc3c(c2)OCCO3)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C18H15NO7/c1-24-17-9-11(8-13(18(17)21)19(22)23)2-4-14(20)12-3-5-15-16(10-12)26-7-6-25-15/h2-5,8-10,21H,6-7H2,1H3 |
| InChIKey | ZKSJLUUTRUYRNY-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 108.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.32 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|