C18H16N2O9S — CID 45474526
2-[[4-[(E)-3-(4-hydroxy-3-methoxy-5-nitrophenyl)prop-2-enoyl]phenyl]sulfonylamino]acetic acid (PubChem CID 45474526) has the molecular formula C18H16N2O9S and a molecular weight of 436.40 g/mol. Its IUPAC name is 2-[[4-[(E)-3-(4-hydroxy-3-methoxy-5-nitrophenyl)prop-2-enoyl]phenyl]sulfonylamino]acetic acid.
| Compound Name | 2-[[4-[(E)-3-(4-hydroxy-3-methoxy-5-nitrophenyl)prop-2-enoyl]phenyl]sulfonylamino]acetic acid |
|---|---|
| PubChem CID | 45474526 |
| Molecular Formula | C18H16N2O9S |
| Molecular Weight | 436.40 g/mol |
| Exact Mass | 436.06 |
| IUPAC Name | 2-[[4-[(E)-3-(4-hydroxy-3-methoxy-5-nitrophenyl)prop-2-enoyl]phenyl]sulfonylamino]acetic acid |
| SMILES | COc1cc(/C=C/C(=O)c2ccc(S(=O)(=O)NCC(=O)O)cc2)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C18H16N2O9S/c1-29-16-9-11(8-14(18(16)24)20(25)26)2-7-15(21)12-3-5-13(6-4-12)30(27,28)19-10-17(22)23/h2-9,19,24H,10H2,1H3,(H,22,23)/b7-2+ |
| InChIKey | DXAXBQIQMXIVRM-FARCUNLSSA-N |
| XLogP | 1.57 |
| TPSA | 173.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.40 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|