C17H14N2O7S — CID 45474474
2-[[4-[(E)-3-(2-nitrophenyl)prop-2-enoyl]phenyl]sulfonylamino]acetic acid (PubChem CID 45474474) has the molecular formula C17H14N2O7S and a molecular weight of 390.37 g/mol. Its IUPAC name is 2-[[4-[(E)-3-(2-nitrophenyl)prop-2-enoyl]phenyl]sulfonylamino]acetic acid.
| Compound Name | 2-[[4-[(E)-3-(2-nitrophenyl)prop-2-enoyl]phenyl]sulfonylamino]acetic acid |
|---|---|
| PubChem CID | 45474474 |
| Molecular Formula | C17H14N2O7S |
| Molecular Weight | 390.37 g/mol |
| Exact Mass | 390.05 |
| IUPAC Name | 2-[[4-[(E)-3-(2-nitrophenyl)prop-2-enoyl]phenyl]sulfonylamino]acetic acid |
| SMILES | O=C(O)CNS(=O)(=O)c1ccc(C(=O)/C=C/c2ccccc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H14N2O7S/c20-16(10-7-12-3-1-2-4-15(12)19(23)24)13-5-8-14(9-6-13)27(25,26)18-11-17(21)22/h1-10,18H,11H2,(H,21,22)/b10-7+ |
| InChIKey | GHRJXDABAPNBNL-JXMROGBWSA-N |
| XLogP | 1.85 |
| TPSA | 143.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.37 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|