C22H18N2O8S — CID 46632163
3-[[4-[(E)-3-[5-(2-nitrophenyl)furan-2-yl]prop-2-enoyl]phenyl]sulfonylamino]propanoic acid (PubChem CID 46632163) has the molecular formula C22H18N2O8S and a molecular weight of 470.46 g/mol. Its IUPAC name is 3-[[4-[(E)-3-[5-(2-nitrophenyl)furan-2-yl]prop-2-enoyl]phenyl]sulfonylamino]propanoic acid.
| Compound Name | 3-[[4-[(E)-3-[5-(2-nitrophenyl)furan-2-yl]prop-2-enoyl]phenyl]sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 46632163 |
| Molecular Formula | C22H18N2O8S |
| Molecular Weight | 470.46 g/mol |
| Exact Mass | 470.08 |
| IUPAC Name | 3-[[4-[(E)-3-[5-(2-nitrophenyl)furan-2-yl]prop-2-enoyl]phenyl]sulfonylamino]propanoic acid |
| SMILES | O=C(O)CCNS(=O)(=O)c1ccc(C(=O)/C=C/c2ccc(-c3ccccc3[N+](=O)[O-])o2)cc1 |
| InChI | InChI=1S/C22H18N2O8S/c25-20(15-5-9-17(10-6-15)33(30,31)23-14-13-22(26)27)11-7-16-8-12-21(32-16)18-3-1-2-4-19(18)24(28)29/h1-12,23H,13-14H2,(H,26,27)/b11-7+ |
| InChIKey | DRNJUEDNCKKEJI-YRNVUSSQSA-N |
| XLogP | 3.50 |
| TPSA | 156.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.46 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|