C19H12Cl2N2O4 — CID 1244901
(E)-N-(2,5-dichlorophenyl)-3-[5-(2-nitrophenyl)furan-2-yl]prop-2-enamide (PubChem CID 1244901) has the molecular formula C19H12Cl2N2O4 and a molecular weight of 403.22 g/mol. Its IUPAC name is (E)-N-(2,5-dichlorophenyl)-3-[5-(2-nitrophenyl)furan-2-yl]prop-2-enamide.
| Compound Name | (E)-N-(2,5-dichlorophenyl)-3-[5-(2-nitrophenyl)furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 1244901 |
| Molecular Formula | C19H12Cl2N2O4 |
| Molecular Weight | 403.22 g/mol |
| Exact Mass | 402.02 |
| IUPAC Name | (E)-N-(2,5-dichlorophenyl)-3-[5-(2-nitrophenyl)furan-2-yl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(-c2ccccc2[N+](=O)[O-])o1)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C19H12Cl2N2O4/c20-12-5-8-15(21)16(11-12)22-19(24)10-7-13-6-9-18(27-13)14-3-1-2-4-17(14)23(25)26/h1-11H,(H,22,24)/b10-7+ |
| InChIKey | LQOQYOSYZNXSGY-JXMROGBWSA-N |
| XLogP | 5.81 |
| TPSA | 85.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.22 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|