C20H13Cl2N3O7 — CID 17050535
(E)-3-[5-(2,3-dichlorophenyl)furan-2-yl]-N-(4-methoxy-3,5-dinitrophenyl)prop-2-enamide (PubChem CID 17050535) has the molecular formula C20H13Cl2N3O7 and a molecular weight of 478.24 g/mol. Its IUPAC name is (E)-3-[5-(2,3-dichlorophenyl)furan-2-yl]-N-(4-methoxy-3,5-dinitrophenyl)prop-2-enamide.
| Compound Name | (E)-3-[5-(2,3-dichlorophenyl)furan-2-yl]-N-(4-methoxy-3,5-dinitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 17050535 |
| Molecular Formula | C20H13Cl2N3O7 |
| Molecular Weight | 478.24 g/mol |
| Exact Mass | 477.01 |
| IUPAC Name | (E)-3-[5-(2,3-dichlorophenyl)furan-2-yl]-N-(4-methoxy-3,5-dinitrophenyl)prop-2-enamide |
| SMILES | COc1c([N+](=O)[O-])cc(NC(=O)/C=C/c2ccc(-c3cccc(Cl)c3Cl)o2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H13Cl2N3O7/c1-31-20-15(24(27)28)9-11(10-16(20)25(29)30)23-18(26)8-6-12-5-7-17(32-12)13-3-2-4-14(21)19(13)22/h2-10H,1H3,(H,23,26)/b8-6+ |
| InChIKey | VFQSYVKXVVNOTN-SOFGYWHQSA-N |
| XLogP | 5.73 |
| TPSA | 137.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.24 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|