C21H16ClN3O7 — CID 17358232
(E)-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]-N-(4-methoxy-3,5-dinitrophenyl)prop-2-enamide (PubChem CID 17358232) has the molecular formula C21H16ClN3O7 and a molecular weight of 457.83 g/mol. Its IUPAC name is (E)-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]-N-(4-methoxy-3,5-dinitrophenyl)prop-2-enamide.
| Compound Name | (E)-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]-N-(4-methoxy-3,5-dinitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 17358232 |
| Molecular Formula | C21H16ClN3O7 |
| Molecular Weight | 457.83 g/mol |
| Exact Mass | 457.07 |
| IUPAC Name | (E)-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]-N-(4-methoxy-3,5-dinitrophenyl)prop-2-enamide |
| SMILES | COc1c([N+](=O)[O-])cc(NC(=O)/C=C/c2ccc(-c3ccc(C)c(Cl)c3)o2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H16ClN3O7/c1-12-3-4-13(9-16(12)22)19-7-5-15(32-19)6-8-20(26)23-14-10-17(24(27)28)21(31-2)18(11-14)25(29)30/h3-11H,1-2H3,(H,23,26)/b8-6+ |
| InChIKey | FLLRXWBMVGHAIA-SOFGYWHQSA-N |
| XLogP | 5.39 |
| TPSA | 137.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.83 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|