C21H17ClN2O5 — CID 4680460
3-[5-(3-chloro-4-methylphenyl)furan-2-yl]-N-(4-methoxy-2-nitrophenyl)prop-2-enamide (PubChem CID 4680460) has the molecular formula C21H17ClN2O5 and a molecular weight of 412.83 g/mol. Its IUPAC name is 3-[5-(3-chloro-4-methylphenyl)furan-2-yl]-N-(4-methoxy-2-nitrophenyl)prop-2-enamide.
| Compound Name | 3-[5-(3-chloro-4-methylphenyl)furan-2-yl]-N-(4-methoxy-2-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 4680460 |
| Molecular Formula | C21H17ClN2O5 |
| Molecular Weight | 412.83 g/mol |
| Exact Mass | 412.08 |
| IUPAC Name | 3-[5-(3-chloro-4-methylphenyl)furan-2-yl]-N-(4-methoxy-2-nitrophenyl)prop-2-enamide |
| SMILES | COc1ccc(NC(=O)C=Cc2ccc(-c3ccc(C)c(Cl)c3)o2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H17ClN2O5/c1-13-3-4-14(11-17(13)22)20-9-6-15(29-20)7-10-21(25)23-18-8-5-16(28-2)12-19(18)24(26)27/h3-12H,1-2H3,(H,23,25) |
| InChIKey | LKSSURRHHSLKNB-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 94.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.83 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|