C24H22Cl2N2O2 — CID 22781365
(E)-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]-N-(3-chloro-4-pyrrolidin-1-ylphenyl)prop-2-enamide (PubChem CID 22781365) has the molecular formula C24H22Cl2N2O2 and a molecular weight of 441.36 g/mol. Its IUPAC name is (E)-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]-N-(3-chloro-4-pyrrolidin-1-ylphenyl)prop-2-enamide.
| Compound Name | (E)-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]-N-(3-chloro-4-pyrrolidin-1-ylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 22781365 |
| Molecular Formula | C24H22Cl2N2O2 |
| Molecular Weight | 441.36 g/mol |
| Exact Mass | 440.11 |
| IUPAC Name | (E)-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]-N-(3-chloro-4-pyrrolidin-1-ylphenyl)prop-2-enamide |
| SMILES | Cc1ccc(-c2ccc(/C=C/C(=O)Nc3ccc(N4CCCC4)c(Cl)c3)o2)cc1Cl |
| InChI | InChI=1S/C24H22Cl2N2O2/c1-16-4-5-17(14-20(16)25)23-10-7-19(30-23)8-11-24(29)27-18-6-9-22(21(26)15-18)28-12-2-3-13-28/h4-11,14-15H,2-3,12-13H2,1H3,(H,27,29)/b11-8+ |
| InChIKey | WVTPXJCHICANHE-DHZHZOJOSA-N |
| XLogP | 6.81 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.36 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|