C31H27ClFN3O3 — CID 43913976
(E)-N-[3-chloro-4-[4-(2-methylbenzoyl)piperazin-1-yl]phenyl]-3-[5-(4-fluorophenyl)furan-2-yl]prop-2-enamide (PubChem CID 43913976) has the molecular formula C31H27ClFN3O3 and a molecular weight of 544.03 g/mol. Its IUPAC name is (E)-N-[3-chloro-4-[4-(2-methylbenzoyl)piperazin-1-yl]phenyl]-3-[5-(4-fluorophenyl)furan-2-yl]prop-2-enamide.
| Compound Name | (E)-N-[3-chloro-4-[4-(2-methylbenzoyl)piperazin-1-yl]phenyl]-3-[5-(4-fluorophenyl)furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 43913976 |
| Molecular Formula | C31H27ClFN3O3 |
| Molecular Weight | 544.03 g/mol |
| Exact Mass | 543.17 |
| IUPAC Name | (E)-N-[3-chloro-4-[4-(2-methylbenzoyl)piperazin-1-yl]phenyl]-3-[5-(4-fluorophenyl)furan-2-yl]prop-2-enamide |
| SMILES | Cc1ccccc1C(=O)N1CCN(c2ccc(NC(=O)/C=C/c3ccc(-c4ccc(F)cc4)o3)cc2Cl)CC1 |
| InChI | InChI=1S/C31H27ClFN3O3/c1-21-4-2-3-5-26(21)31(38)36-18-16-35(17-19-36)28-13-10-24(20-27(28)32)34-30(37)15-12-25-11-14-29(39-25)22-6-8-23(33)9-7-22/h2-15,20H,16-19H2,1H3,(H,34,37)/b15-12+ |
| InChIKey | KSGWFPSALIZPQK-NTCAYCPXSA-N |
| XLogP | 6.66 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.03 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|