C33H30FN3O5 — CID 43914493
ethyl 4-(4-benzoylpiperazin-1-yl)-3-[[(E)-3-[5-(4-fluorophenyl)furan-2-yl]prop-2-enoyl]amino]benzoate (PubChem CID 43914493) has the molecular formula C33H30FN3O5 and a molecular weight of 567.62 g/mol. Its IUPAC name is ethyl 4-(4-benzoylpiperazin-1-yl)-3-[[(E)-3-[5-(4-fluorophenyl)furan-2-yl]prop-2-enoyl]amino]benzoate.
| Compound Name | ethyl 4-(4-benzoylpiperazin-1-yl)-3-[[(E)-3-[5-(4-fluorophenyl)furan-2-yl]prop-2-enoyl]amino]benzoate |
|---|---|
| PubChem CID | 43914493 |
| Molecular Formula | C33H30FN3O5 |
| Molecular Weight | 567.62 g/mol |
| Exact Mass | 567.22 |
| IUPAC Name | ethyl 4-(4-benzoylpiperazin-1-yl)-3-[[(E)-3-[5-(4-fluorophenyl)furan-2-yl]prop-2-enoyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(N2CCN(C(=O)c3ccccc3)CC2)c(NC(=O)/C=C/c2ccc(-c3ccc(F)cc3)o2)c1 |
| InChI | InChI=1S/C33H30FN3O5/c1-2-41-33(40)25-10-15-29(36-18-20-37(21-19-36)32(39)24-6-4-3-5-7-24)28(22-25)35-31(38)17-14-27-13-16-30(42-27)23-8-11-26(34)12-9-23/h3-17,22H,2,18-21H2,1H3,(H,35,38)/b17-14+ |
| InChIKey | ONIPSZJURFYUMW-SAPNQHFASA-N |
| XLogP | 5.88 |
| TPSA | 92.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.62 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|